CAS 74049-08-4
:2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer
Description:
The chemical substance known as "2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer" (CAS number 74049-08-4) is a fluorinated polymer derived from the polymerization of a fluorinated acrylate monomer. This compound exhibits unique characteristics due to the presence of fluorinated chains, which impart exceptional chemical resistance, thermal stability, and low surface energy. As a result, it is often utilized in applications requiring non-stick properties, such as coatings and sealants. The fluorinated segments contribute to hydrophobicity and oleophobicity, making it effective in repelling water and oils. Additionally, the polymer's structure allows for flexibility and durability, enhancing its performance in various industrial applications. Its synthesis typically involves free radical polymerization, and it may be processed into films, fibers, or coatings. Safety and handling precautions are essential due to the potential environmental impact of fluorinated compounds, necessitating adherence to regulatory guidelines during use and disposal.
Formula:(C13H7F17O2)x
InChI:InChI=1S/C13H7F17O2/c1-2-5(31)32-4-3-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h2H,1,3-4H2
InChI key:InChIKey=QUKRIOLKOHUUBM-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(CCOC(C=C)=O)(F)F)(F)F)(F)F)(F)F
Synonyms:- (Perfluorooctyl)ethyl acrylate homopolymer
- FA 8
- Poly(1H,1H,2H,2H-heptadecafluorodecyl acrylate)
- Fluowet AE 800 homopolymer
- 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer
CAS:Formula:C13H7F17O2Molecular weight:518.1663
