CAS 7405-23-4

1,3-Benzothiazol-4-ol

Description:

1,3-Benzothiazol-4-ol, with the CAS number 7405-23-4, is an organic compound that features a benzothiazole ring system, which consists of a fused benzene and thiazole ring. This compound is characterized by the presence of a hydroxyl group (-OH) at the 4-position of the thiazole ring, contributing to its chemical reactivity and potential applications. It typically appears as a solid or crystalline substance and is soluble in polar solvents. 1,3-Benzothiazol-4-ol exhibits properties such as being a weak acid due to the hydroxyl group, and it can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activities and utility as a building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₄NOS

InChI: InChI=1/C7H5NOS/c9-5-2-1-3-6-7(5)8-4-10-6/h1-4,9H

SMILES: c1cc(c2c(c1)scn2)O

Synonyms:

• 4-Benzothiazolol
• Benzothiazol-4-ol

Benzo[d]thiazol-4-ol

CAS: 7405-23-4

Formula: C₇H₅NOS

Purity: 96%

Color and Shape: Solid

Molecular weight: 151.1857

Ref: IN-DA005HN1

1,3-benzothiazol-4-ol

CAS: 7405-23-4

1,3-benzothiazol-4-ol

Formula: C₇H₅NOS

Purity: 98%

Color and Shape: light green to green solid

Molecular weight: 151.19g/mol

Ref: 54-OR480534

Benzo[d]thiazol-4-ol

CAS: 7405-23-4

Formula: C₇H₅NOS

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 151.18

Ref: 10-F221627