CAS 74051-20-0
:1-[3-(trifluoromethyl)phenyl]butan-2-amine
Description:
1-[3-(Trifluoromethyl)phenyl]butan-2-amine, with the CAS number 74051-20-0, is an organic compound characterized by its amine functional group and a butane backbone. This compound features a trifluoromethyl group attached to a phenyl ring, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the trifluoromethyl group often enhances the compound's stability and can affect its reactivity, making it of interest in medicinal chemistry and material science. The amine group can participate in hydrogen bonding, influencing solubility and interaction with biological targets. Typically, compounds like this may exhibit various pharmacological activities, and their synthesis often involves multi-step organic reactions. Additionally, the trifluoromethyl group can impart unique electronic properties, making such compounds valuable in the development of agrochemicals and pharmaceuticals. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated compounds, necessitating appropriate precautions during laboratory work.
Formula:C11H14F3N
InChI:InChI=1/C11H14F3N/c1-2-10(15)7-8-4-3-5-9(6-8)11(12,13)14/h3-6,10H,2,7,15H2,1H3
SMILES:CCC(Cc1cccc(c1)C(F)(F)F)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.