CymitQuimica logo

CAS 74051-73-3

:

1H-indazol-5-amine dihydroiodide

Description:
1H-Indazol-5-amine dihydroiodide is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) at the 5-position of the indazole ring, contributing to its reactivity and potential biological activity. The dihydroiodide form indicates the presence of two iodide ions associated with the amine, which can influence the compound's solubility and stability. Typically, compounds like this may exhibit properties such as being hygroscopic and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of iodine can also enhance the compound's reactivity in various chemical reactions. As with many nitrogen-containing heterocycles, 1H-indazol-5-amine dihydroiodide may interact with biological targets, making it of interest in drug discovery and development. Safety and handling precautions should be observed due to the potential toxicity associated with iodine-containing compounds.
Formula:C7H9I2N3
InChI:InChI=1/C7H7N3.2HI/c8-6-1-2-7-5(3-6)4-9-10-7;;/h1-4H,8H2,(H,9,10);2*1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.