CymitQuimica logo

CAS 74058-21-2

:

4-(2-hydroxyethyl)cyclohexanol

Description:
4-(2-Hydroxyethyl)cyclohexanol, with the CAS number 74058-21-2, is an organic compound characterized by a cyclohexane ring substituted with a hydroxyl group and a hydroxyethyl group. This compound is a colorless to pale yellow liquid at room temperature and is soluble in water due to the presence of the hydroxyl groups, which can form hydrogen bonds. Its molecular structure contributes to its potential applications in various fields, including as a solvent, in the synthesis of other chemical compounds, and in formulations for personal care products. The presence of both a cyclohexanol moiety and a hydroxyethyl group suggests that it may exhibit properties such as moderate viscosity and surface activity. Additionally, it may have implications in the development of surfactants or emulsifiers due to its amphiphilic nature. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C8H16O2
InChI:InChI=1/C8H16O2/c9-6-5-7-1-3-8(10)4-2-7/h7-10H,1-6H2
InChI key:SZIBVWWQOOVXHS-UHFFFAOYSA-N
SMILES:C1CC(CCC1CCO)O
Synonyms:
  • Cyclohexaneethanol, 4-Hydroxy-
  • 4-(2-Hydroxyethyl)cyclohexanol
Found 5 products.