CAS 74058-71-2
:N-(Phenylmethyl)hexadecanamide
Description:
N-(Phenylmethyl)hexadecanamide, also known by its CAS number 74058-71-2, is an organic compound characterized by its long hydrophobic hydrocarbon chain and an amide functional group. This substance features a hexadecanamide backbone, which consists of a 16-carbon saturated fatty acid chain, linked to a phenylmethyl group (benzyl group) at the nitrogen atom of the amide. The presence of both the hydrophobic alkyl chain and the aromatic phenylmethyl group contributes to its amphiphilic nature, potentially allowing it to interact with both polar and nonpolar environments. This compound may exhibit properties such as surfactancy, solubility in organic solvents, and potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure suggests it could participate in hydrogen bonding due to the amide group, influencing its physical properties like melting and boiling points. Additionally, the compound's stability and reactivity can be affected by the length of the hydrocarbon chain and the nature of the substituents on the nitrogen atom.
Formula:C23H39NO
InChI:InChI=1S/C23H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23(25)24-21-22-18-15-14-16-19-22/h14-16,18-19H,2-13,17,20-21H2,1H3,(H,24,25)
InChI key:InChIKey=MLGPKWUKOQAAGI-UHFFFAOYSA-N
SMILES:C(NC(CCCCCCCCCCCCCCC)=O)C1=CC=CC=C1
Synonyms:- N-Benzylpalmitamide
- N-Benzylhexadecanamide
- Hexadecanamide, N-(phenylmethyl)-
- N-(Phenylmethyl)hexadecanamide
- Hexadecanamide, N-benzyl-
- Macamide Impurity 4
- Macamide B, Macamide Impurity 1
- Macamide 1
- Macamide B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
N-Benzylpalmitamide
CAS:Aromatic cyclic amides (including cyclic carbamates) and their derivatives; salts thereofFormula:C23H39NOColor and Shape:White PowderMolecular weight:345.30316N-Benzylpalmitamide
CAS:N-Benzylpalmitamide (Macamide 1) inhibits fatty acid amide hydrolase (FAAH) in a time-dependent manner and could potentially offer a good alternative for theFormula:C23H39NOPurity:97.08% - 99.77%Color and Shape:SolidMolecular weight:345.56Macamide b
CAS:Natural alkaloidFormula:C23H39NOPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:345.56N-Benzyl Hexadecanamide
CAS:Controlled ProductFormula:C23H39NOColor and Shape:NeatMolecular weight:345.562N-Benzyl Hexadecanamide
CAS:N-Benzyl Hexadecanamide is a long-chain amide that is used in analytical chemistry as a sample preparation agent and to extract fatty acids from biological samples. It has been shown to have neuroprotective properties by reducing the uptake of glutamate and preventing neuronal cell death. N-Benzyl Hexadecanamide has also been found to prevent tumor growth and induce apoptosis in human cancer cells, which may be due to its ability to inhibit creatine kinase activity. This compound has also been shown to have anti-inflammatory effects, which are mediated through the inhibition of the activation of nuclear factor kappa B (NF-κB).
Formula:C23H39NOPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:345.56 g/mol









