CymitQuimica logo

CAS 74065-65-9

:

8,11,14,17,20,23,26-Heptaoxa-32,33-diazatricyclo[26.3.1.12,6]tritriaconta-1(32),2,4,6(33),28,30-hexaene

Description:
The chemical substance known as "8,11,14,17,20,23,26-Heptaoxa-32,33-diazatricyclo[26.3.1.12,6]tritriaconta-1(32),2,4,6(33),28,30-hexaene" with the CAS number 74065-65-9 is a complex organic compound characterized by its unique polycyclic structure, which includes multiple oxygen and nitrogen atoms integrated into its framework. This compound features a series of interconnected rings, contributing to its rigidity and potential for unique electronic properties. The presence of multiple oxygen atoms suggests that it may exhibit significant polar characteristics, while the nitrogen atoms could impart basicity or influence reactivity. The hexaene component indicates the presence of conjugated double bonds, which may allow for interesting optical properties, such as light absorption or emission. Such compounds are often of interest in materials science, particularly in the development of organic semiconductors or advanced polymers. However, specific applications and behaviors would depend on further empirical studies and characterization techniques to elucidate its properties in detail.
Formula:C24H34N2O7
InChI:InChI=1S/C24H34N2O7/c1-3-21-19-32-17-15-30-13-11-28-9-7-27-8-10-29-12-14-31-16-18-33-20-22-4-2-6-24(26-22)23(5-1)25-21/h1-6H,7-20H2
InChI key:InChIKey=PHBJEXHECOHKGT-UHFFFAOYSA-N
SMILES:C1=2C=3N=C(C=CC3)COCCOCCOCCOCCOCCOCCOCC(=N1)C=CC2
Synonyms:
  • 8,11,14,17,20,23,26-Heptaoxa-32,33-diazatricyclo[26.3.1.12,6]tritriaconta-1(32),2,4,6(33),28,30-hexaene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.