CAS 74069-74-2
:(R)-(-)-2-Aminononane
Description:
(R)-(-)-2-Aminononane, with the CAS number 74069-74-2, is an organic compound classified as an aminoalkane. It features a nonane backbone with an amino group (-NH2) attached to the second carbon, making it a chiral molecule with specific stereochemistry. The "(R)" designation indicates the configuration of the chiral center, which influences its biological activity and interactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. (R)-(-)-2-Aminononane is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential as a building block for more complex molecules. Its properties, such as boiling point, melting point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H21N
InChI:InChI=1/C9H21N/c1-3-4-5-6-7-8-9(2)10/h9H,3-8,10H2,1-2H3/t9-/m1/s1
SMILES:CCCCCCC[C@@H](C)N
Synonyms:- (2R)-Nonan-2-amine
- 2-nonanamine, (2R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-(-)-2-Aminononane, ChiPros 99+%, ee 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H21NPurity:98+%Color and Shape:Clear, colourless, liquidMolecular weight:143.27


