CAS 74073-40-8

2-Bromo-3-chlorobenzaldehyde

Description:

2-Bromo-3-chlorobenzaldehyde is an aromatic compound characterized by the presence of both bromine and chlorine substituents on a benzaldehyde ring. Specifically, the bromine atom is located at the second position and the chlorine atom at the third position relative to the aldehyde functional group. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is known for its reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The halogen substituents can influence the compound's reactivity and polarity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-3-chlorobenzaldehyde may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₇H₄BrClO

InChI: InChI=1/C7H4BrClO/c8-7-5(4-10)2-1-3-6(7)9/h1-4H

Synonyms:

• Benzaldehyde, 2-bromo-3-chloro-
• 2-BROMO-3-CHLOROBENZALDEHYDE

2-Bromo-3-chlorobenzaldehyde

CAS: 74073-40-8

Formula: C₇H₄BrClO

Purity: 96%

Color and Shape: Solid

Molecular weight: 219.4631

Ref: IN-DA0036II

2-Bromo-3-chlorobenzaldehyde

CAS: 74073-40-8

2-Bromo-3-chlorobenzaldehyde

Purity: 98%

Molecular weight: 219.46g/mol

Ref: 54-OR400100

2-Bromo-3-chlorobenzaldehyde

CAS: 74073-40-8

Formula: C₇H₄BrClO

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.46

Ref: 10-F038278