CAS 74074-78-5
:4-{2-[(2,2,2-trifluoroethyl)amino]ethyl}benzene-1,2-diol hydrobromide (1:1)
Description:
4-{2-[(2,2,2-trifluoroethyl)amino]ethyl}benzene-1,2-diol hydrobromide (1:1) is a chemical compound characterized by its specific molecular structure, which includes a benzene ring substituted with two hydroxyl groups (1,2-diol) and an aminoethyl side chain that contains a trifluoroethyl group. The presence of the hydrobromide indicates that the compound is in its salt form, which enhances its solubility in polar solvents, making it useful in various applications, including pharmaceuticals. The trifluoroethyl group contributes to the compound's lipophilicity and may influence its biological activity, potentially affecting its interaction with biological membranes or receptors. The compound's hydrobromide salt form can also affect its stability and bioavailability. Overall, this substance is of interest in medicinal chemistry and may be studied for its pharmacological properties, including potential therapeutic effects or mechanisms of action. As with any chemical, proper handling and safety precautions should be observed due to its specific properties and potential biological effects.
Formula:C10H13BrF3NO2
InChI:InChI=1/C10H12F3NO2.BrH/c11-10(12,13)6-14-4-3-7-1-2-8(15)9(16)5-7;/h1-2,5,14-16H,3-4,6H2;1H
SMILES:c1cc(c(cc1CCNCC(F)(F)F)O)O.Br
Synonyms:- 1,2-Benzenediol, 4-(2-((2,2,2-trifluoroethyl)amino)ethyl)-, hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.