CAS 740768-99-4

azetidine-3-carboxamide

Description:

Azetidine-3-carboxamide is a cyclic amide characterized by its four-membered ring structure, which includes a nitrogen atom and a carboxamide functional group. This compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to act as a building block for more complex molecules. The presence of the carboxamide group contributes to its polar nature, influencing its solubility and reactivity. Azetidine-3-carboxamide may exhibit biological activity, making it of interest in drug discovery and development. Its structural features allow for various modifications, which can enhance its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, azetidine-3-carboxamide represents a versatile scaffold in organic synthesis and medicinal chemistry, with ongoing research exploring its full potential in various applications.

Formula: C₄H₈N₂O

InChI: InChI=1/C4H8N2O/c5-4(7)3-1-6-2-3/h3,6H,1-2H2,(H2,5,7)

SMILES: C1C(CN1)C(=N)O

Azetidine-3-carboxamide

CAS: 740768-99-4

Formula: C₄H₈N₂O

Molecular weight: 100.1191

Ref: IN-DA008P60

Azetidine-3-carboxamide

CAS: 740768-99-4

Azetidine-3-carboxamide

Purity: ≥95%

Color and Shape: Off-White Powder

Molecular weight: 100.12g/mol

Ref: 54-OR308017

Azetidine-3-carboxamide

CAS: 740768-99-4

Formula: C₄H₈N₂O

Purity: 95.0%

Color and Shape: Off-white powder

Molecular weight: 100.121

Ref: 10-F230039