CAS 740774-41-8
:(R)-4-Amino-3-(4-methoxyphenyl)butanoic acid
Description:
(R)-4-Amino-3-(4-methoxyphenyl)butanoic acid, also known as (R)-4-Amino-3-(p-methoxyphenyl)butanoic acid, is an amino acid derivative characterized by its chiral center, which contributes to its specific stereochemistry. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a methoxy-substituted phenyl group, which influences its solubility and reactivity. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with receptors. As a chiral molecule, it may exhibit different pharmacological properties compared to its enantiomer. This compound is of interest in pharmaceutical research, particularly in the development of drugs targeting neurological conditions, as it may act as a modulator of neurotransmitter systems. Its molecular structure allows for various interactions with biological macromolecules, making it a candidate for further studies in medicinal chemistry. Safety and handling considerations should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C11H15NO3
InChI:InChI=1/C11H15NO3/c1-15-10-4-2-8(3-5-10)9(7-12)6-11(13)14/h2-5,9H,6-7,12H2,1H3,(H,13,14)/t9-/m0/s1
SMILES:COc1ccc(cc1)[C@@H](CC(=O)O)CN
Synonyms:- (3R)-4-Amino-3-(4-methoxyphenyl)butanoic acid
- benzenepropanoic acid, beta-(aminomethyl)-4-methoxy-, (betaR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.