CAS 7408-20-0
:(2S,2'S)-2,2'-iminodibutanedioic acid (non-preferred name)
Description:
(2S,2'S)-2,2'-iminodibutanedioic acid, also known by its CAS number 7408-20-0, is an organic compound characterized by its structure, which features two butanedioic acid moieties linked by an imino group. This compound is a chiral molecule, possessing two stereocenters, which contributes to its potential biological activity and interactions. It is typically a white crystalline solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of carboxylic acid functional groups. The imino linkage introduces unique reactivity, making it of interest in various chemical syntheses and potential applications in pharmaceuticals or biochemistry. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. As with many organic acids, it may exhibit acidic behavior in solution, contributing to its role in biochemical pathways or as a building block in organic synthesis.
Formula:C8H11NO8
InChI:InChI=1/C8H11NO8/c10-5(11)1-3(7(14)15)9-4(8(16)17)2-6(12)13/h3-4,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t3-,4-/m0/s1
SMILES:C([C@@H](C(=O)O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O
Synonyms:- (2S,2'S)-2,2'-Iminodisuccinic acid (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.