CAS 7408-81-3
:12-Methylaminolauric acid
Description:
12-Methylaminolauric acid, with the CAS number 7408-81-3, is an organic compound that belongs to the class of fatty acids and amines. It features a long hydrocarbon chain, specifically a lauric acid backbone, which is a saturated fatty acid with 12 carbon atoms. The presence of a methylamino group at the 12th carbon position introduces both hydrophobic and hydrophilic characteristics, making it amphiphilic. This property allows it to function effectively as a surfactant, facilitating the reduction of surface tension in various applications. The compound is typically used in the formulation of detergents, emulsifiers, and other surface-active agents. Its structure contributes to its ability to interact with both water and oils, enhancing solubility and stability in mixtures. Additionally, 12-Methylaminolauric acid may exhibit antimicrobial properties, making it useful in personal care products and industrial applications. Safety and handling considerations should be observed, as with many chemical substances, to mitigate any potential hazards associated with its use.
Formula:C13H27NO2
InChI:InChI=1/C13H27NO2/c1-14-12-10-8-6-4-2-3-5-7-9-11-13(15)16/h14H,2-12H2,1H3,(H,15,16)
InChI key:InChIKey=XTXRYZLZPWMJBM-UHFFFAOYSA-N
SMILES:C(CCCCCCNC)CCCCC(O)=O
Synonyms:- 12-(Methylamino)dodecanoic acid
- 12-Methylaminolauric acid
- Dodecanoic acid, 12-(methylamino)-
- 12-(METHYLAMINO)LAURIC ACID
- Einecs 231-017-3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
