CAS 740810-42-8

5-(1,1-Dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one

Description:

The chemical substance known as 5-(1,1-Dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one, with the CAS number 740810-42-8, is a complex organic compound characterized by its polyphenolic structure. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of alkyl substituents, such as the dimethyl-2-propenyl and 3-methyl-2-butenyl groups, suggests that the compound may exhibit unique reactivity and solubility characteristics. This compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic regions. Its structural features may also indicate potential applications in fields such as pharmaceuticals, where compounds with antioxidant and anti-inflammatory properties are of interest. Additionally, the xanthene core is known for its fluorescent properties, which could make this compound useful in various analytical and imaging techniques. Overall, this compound represents a fascinating area of study within organic chemistry and materials science.

Formula: C₂₃H₂₄O₆

InChI: InChI=1S/C23H24O6/c1-6-23(4,5)19-14(25)9-13(24)18-21(28)17-12(8-7-11(2)3)20(27)15(26)10-16(17)29-22(18)19/h6-7,9-10,24-27H,1,8H2,2-5H3

InChI key: InChIKey=FUEJTEBWTNXAPG-UHFFFAOYSA-N

SMILES: C(C=C(C)C)C1=C2C(OC=3C(C2=O)=C(O)C=C(O)C3C(C=C)(C)C)=CC(O)=C1O

Synonyms:

• 5-(1,1-Dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one
• 9H-Xanthen-9-one, 5-(1,1-dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-
• Cudratricusxanthone A
• 9H-Xanthen-9-one, 5-(1,1-dimethyl-2-propenyl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-butenyl)-

Cudratricusxanthone A

CAS: 740810-42-8

Formula: C₂₃H₂₄O₆

Purity: 95%~99%

Molecular weight: 396.439

Ref: BP-SBP00241

Cudratricusxanthone A

CAS: 740810-42-8

Cudratricusxanthone A is a natural bioactive compound, specifically a xanthone, which is derived from the root bark of the plant Cudrania tricuspidata. This compound is renowned for its unique chemical structure and its biological activities, primarily attributed to its potent antioxidant and anti-inflammatory properties. The mode of action involves the inhibition of pro-inflammatory pathways and the scavenging of free radicals, thereby reducing oxidative stress and mitigating inflammatory responses at the cellular level.

Formula: C₂₃H₂₄O₆

Purity: Min. 95%

Molecular weight: 396.4 g/mol

Ref: 3D-QEB81042