CAS 74082-06-7

Butanoic acid, 2-ethyl-, 2-methylpropyl ester

Description:

Butanoic acid, 2-ethyl-, 2-methylpropyl ester, also known by its CAS number 74082-06-7, is an organic compound classified as an ester. Esters are typically formed from the reaction of an alcohol and a carboxylic acid, and in this case, the structure indicates that it is derived from butanoic acid and a branched alcohol. This compound is characterized by its fruity odor, which is common among many esters, making it potentially useful in flavoring and fragrance applications. It is likely to be a colorless to pale yellow liquid at room temperature, with moderate solubility in water due to the presence of the butanoic acid moiety. The compound may exhibit typical ester properties, such as low volatility and a relatively low boiling point compared to larger, more complex molecules. Additionally, it may participate in various chemical reactions, including hydrolysis and transesterification, under appropriate conditions. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.

Formula: C₁₀H₂₀O₂

InChI: InChI=1S/C10H20O2/c1-5-9(6-2)10(11)12-7-8(3)4/h8-9H,5-7H2,1-4H3

InChI key: InChIKey=SAWRJLRKAZYKPM-UHFFFAOYSA-N

SMILES: C(C(OCC(C)C)=O)(CC)CC

Synonyms:

• 2-Methylpropyl 2-ethylbutanoate
• NSC 20011
• Isobutyl 2-ethylbutyrate
• Butanoic acid, 2-ethyl-, 2-methylpropyl ester