
CAS 740842-52-8
:Carbamic acid, (6,7,8,9-tetrahydro-7-oxo-5H-benzocyclohepten-2-yl)-, phenylmethyl ester
Description:
Carbamic acid, (6,7,8,9-tetrahydro-7-oxo-5H-benzocyclohepten-2-yl)-, phenylmethyl ester, identified by CAS number 740842-52-8, is a chemical compound characterized by its complex structure, which includes a carbamic acid moiety and a phenylmethyl ester group. This compound features a bicyclic framework, contributing to its unique chemical properties. It is likely to exhibit moderate to high lipophilicity due to the presence of the aromatic phenyl group, which can influence its solubility and interaction with biological systems. The presence of the tetrahydrobenzocycloheptene structure may impart specific stereochemical properties, affecting its reactivity and potential biological activity. As a carbamate derivative, it may also exhibit characteristics typical of this class, such as potential inhibition of certain enzymes or receptors. The compound's stability, reactivity, and potential applications would depend on its specific functional groups and overall molecular conformation, making it of interest in medicinal chemistry and related fields. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C19H19NO3
InChI:InChI=1S/C19H19NO3/c21-18-10-7-15-6-9-17(12-16(15)8-11-18)20-19(22)23-13-14-4-2-1-3-5-14/h1-6,9,12H,7-8,10-11,13H2,(H,20,22)
InChI key:InChIKey=ZJPVVWTVGDMYJS-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C=2C=C3C(=CC2)CCC(=O)CC3
Synonyms:- (7-Oxo-6,7,8,9-tetrahydro-5H-benzocyclohepten-2-yl)-carbamic acid benzyl ester
- Carbamic acid, (6,7,8,9-tetrahydro-7-oxo-5H-benzocyclohepten-2-yl)-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.