
CAS 740842-80-2
:2,3,4,5-Tetrahydro-1H-1-benzazepin-7-amine
Description:
2,3,4,5-Tetrahydro-1H-1-benzazepin-7-amine is a bicyclic organic compound characterized by its unique structure, which includes a benzene ring fused to a seven-membered azepine ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The amine functional group at the 7-position enhances its potential for hydrogen bonding and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. As a relatively complex organic molecule, it may also serve as a precursor or intermediate in the synthesis of more complex pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c11-9-4-5-10-8(7-9)3-1-2-6-12-10/h4-5,7,12H,1-3,6,11H2
InChI key:InChIKey=BCRMBODVQGTIAW-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=CC1)NCCCC2
Synonyms:- 2,3,4,5-Tetrahydro-1H-benzo[b]azepin-7-amine
- 1H-1-Benzazepin-7-amine, 2,3,4,5-tetrahydro-
- 2,3,4,5-Tetrahydro-1H-benzo[b]azepin-7-ylamine
- 2,3,4,5-Tetrahydro-1H-1-benzazepin-7-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.