
CAS 740842-86-8
:7-Bromo-2,3,4,5-tetrahydro-1H-3-benzazepine
Description:
7-Bromo-2,3,4,5-tetrahydro-1H-3-benzazepine is a chemical compound characterized by its bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. The presence of a bromine atom at the 7-position contributes to its reactivity and potential biological activity. This compound is part of the benzazepine family, which is known for various pharmacological properties, including potential applications in neuropharmacology. The tetrahydro configuration indicates that the compound is saturated, which can influence its solubility and interaction with biological systems. Its molecular structure suggests that it may engage in hydrogen bonding and other intermolecular interactions, making it a candidate for further research in medicinal chemistry. The CAS number 740842-86-8 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 7-Bromo-2,3,4,5-tetrahydro-1H-3-benzazepine presents interesting characteristics for exploration in both synthetic and applied chemistry contexts.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6H2
InChI key:InChIKey=ZVNFJSFIRKPMES-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=CC1)CCNCC2
Synonyms:- 7-Bromo-2,3,4,5-tetrahydro-1H-3-benzazepine
- 1H-3-Benzazepine, 7-bromo-2,3,4,5-tetrahydro-
- 7-Bromo-2,3,4,5-tetrahydro-1H-benzo[d]azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.