CAS 740842-87-9

7-Bromo-2,3,4,5-tetrahydro-1H-2-benzazepine

Description:

7-Bromo-2,3,4,5-tetrahydro-1H-2-benzazepine is a bicyclic compound characterized by its unique structure, which includes a bromine atom and a fused benzene and azepine ring system. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine substituent. The tetrahydro configuration indicates that the compound is saturated, which can influence its stability and reactivity. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the presence of the bromine atom. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. The specific interactions and applications can vary widely depending on the functional groups and the overall molecular context. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.

Formula: C₁₀H₁₂BrN

InChI: InChI=1S/C10H12BrN/c11-10-4-3-9-7-12-5-1-2-8(9)6-10/h3-4,6,12H,1-2,5,7H2

InChI key: InChIKey=WQZWMJXOLQUALN-UHFFFAOYSA-N

SMILES: BrC=1C=C2C(=CC1)CNCCC2

Synonyms:

• 7-Bromo-2,3,4,5-tetrahydro-1H-benzo[c]azepine
• 7-Bromo-2,3,4,5-tetrahydro-1H-2-benzazepine
• 1H-2-Benzazepine, 7-bromo-2,3,4,5-tetrahydro-