CAS 740873-06-7
:N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide
Description:
N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide, with CAS number 740873-06-7, is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide functional group, a piperazine ring, and an acetamide moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary based on its structural components. The presence of the cyclohexylmethyl group suggests lipophilicity, which may influence its pharmacokinetic properties, including absorption and distribution in biological systems. The compound's piperazine ring can contribute to its interaction with biological targets, potentially affecting its efficacy and safety profile. Additionally, the overall molecular structure indicates that it may engage in hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. As with many synthetic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other chemical species.
Formula:C23H38N4O3S
InChI:InChI=1S/C23H38N4O3S/c1-20(28)25-22-10-7-11-23(18-22)27-16-14-26(15-17-27)13-6-5-12-24-31(29,30)19-21-8-3-2-4-9-21/h7,10-11,18,21,24H,2-6,8-9,12-17,19H2,1H3,(H,25,28)
InChI key:InChIKey=SPWZXWDPAWDKQE-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(N2CCN(CCCCNS(CC3CCCCC3)(=O)=O)CC2)C=CC1
Synonyms:- N-[3-[4-[4-[(Cyclohexylmethylsulfonyl)amino]butyl]piperazin-1-yl]phenyl]acetamide
- N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide
- Acetamide, N-[3-[4-[4-[[(cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]-
- Naluzotan
- PRX 00023
- Unii-lq54E5B4ew
- TAK-448
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Naluzotan
CAS:Naluzotan(PRX 00023) is a novel and potent 5-HT1A agonist with IC50 and Ki values of approximately 20 nM and 5.1 nM, respectively.Naluzotan is a potent hERG K+Formula:C23H38N4O3SPurity:>99.99%Color and Shape:SolidMolecular weight:450.64Naluzotan
CAS:Naluzotan is a diagnostic agent that is used to identify the receptor binding of 5-HT2A receptors. It can be used for the diagnosis of diseases such as herpes simplex virus, depression, and schizophrenia. Naluzotan binds to 5-HT2A receptors, activating them and causing a chemical reaction. This activation leads to the production of serotonin, which will then bind to 5-HT1A receptors and inhibit serotonin reuptake. Naluzotan is metabolized in the liver by hepatic impairment, but does not affect the serotonergic system or amino function.
Formula:C23H38N4O3SPurity:Min. 95%Molecular weight:450.6 g/mol


