CAS 7409-48-5
:N~2~,N~2~-diethylglycinamide
Description:
N,N-Diethylglycinamide, with the CAS number 7409-48-5, is an organic compound characterized by its amide functional group. It is derived from glycine, where both hydrogen atoms of the amino group are replaced by ethyl groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar nature due to the presence of the amide group. N,N-Diethylglycinamide is known for its potential applications in pharmaceuticals and as a biochemical reagent. Its structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit properties such as moderate toxicity, necessitating careful handling in laboratory settings. As with many organic compounds, its stability and reactivity can be influenced by environmental conditions such as temperature and pH.
Formula:C6H14N2O
InChI:InChI=1/C6H14N2O/c1-3-8(4-2)5-6(7)9/h3-5H2,1-2H3,(H2,7,9)
SMILES:CCN(CC)CC(=N)O
Synonyms:- Acetamide, 2-(Diethylamino)-
- N~2~,N~2~-Diethylglycinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Diethylamino)acetamide
CAS:2-(Diethylamino)acetamide is an aliphatic hydrocarbon that inhibits the replication of viruses. It also has anti-inflammatory activity and can be used to treat respiratory allergies, such as asthma and hay fever. 2-(Diethylamino)acetamide may be used as a scrubbing agent in the removal of pollutants from industrial emissions. The compound is stable at high temperatures and has been shown to inhibit the growth of bacteria by interfering with their respiration process. 2-(Diethylamino)acetamide also inhibits the production of monocarboxylic acids such as formic acid, acetic acid, and lactic acid in bacteria, which are important for their survival.
Formula:C6H14N2OPurity:Min. 95%Molecular weight:130.19 g/mol

