
CAS 7409-88-3
:2-Methoxy-5-(methylsulfonyl)benzenesulfonamide
Description:
2-Methoxy-5-(methylsulfonyl)benzenesulfonamide, with the CAS number 7409-88-3, is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methoxy group and a methylsulfonyl group attached to a benzene ring, contributing to its unique chemical behavior and potential biological activity. The presence of the sulfonamide moiety suggests that it may exhibit properties similar to other sulfonamide drugs, potentially acting as a competitive inhibitor of certain enzymes. The methoxy group can influence the compound's solubility and reactivity, while the methylsulfonyl group may enhance its stability and interaction with biological targets. This compound is typically used in research settings, particularly in medicinal chemistry, to explore its pharmacological effects and potential therapeutic applications. Its structural characteristics may also allow for modifications that could lead to the development of new derivatives with improved efficacy or reduced side effects.
Formula:C8H11NO5S2
InChI:InChI=1S/C8H11NO5S2/c1-14-7-4-3-6(15(2,10)11)5-8(7)16(9,12)13/h3-5H,1-2H3,(H2,9,12,13)
InChI key:InChIKey=GOSKVHXGDXKPJI-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(OC)C=CC(S(C)(=O)=O)=C1
Synonyms:- Benzenesulfonamide, 2-methoxy-5-(methylsulfonyl)-
- 2-Methoxy-5-(methylsulfonyl)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.