CAS 74098-26-3

2-Methylpropyl 1,3-benzodioxole-5-carboxylate

Description:

2-Methylpropyl 1,3-benzodioxole-5-carboxylate, with the CAS number 74098-26-3, is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a benzodioxole moiety, which consists of a fused dioxole ring and a benzene ring, contributing to its aromatic properties and potential biological activity. The presence of the 2-methylpropyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH, which are important considerations in both laboratory and industrial settings. Overall, 2-Methylpropyl 1,3-benzodioxole-5-carboxylate represents a unique structure that may offer diverse applications based on its chemical properties.

Formula: C₁₂H₁₄O₄

InChI: InChI=1S/C12H14O4/c1-8(2)6-14-12(13)9-3-4-10-11(5-9)16-7-15-10/h3-5,8H,6-7H2,1-2H3

InChI key: InChIKey=NQAZSYLIZHQVQH-UHFFFAOYSA-N

SMILES: C(OCC(C)C)(=O)C=1C=C2C(=CC1)OCO2

Synonyms:

• 2-Methylpropyl 1,3-benzodioxole-5-carboxylate
• 1,3-Benzodioxole-5-carboxylic acid, 2-methylpropyl ester