
CAS 74099-09-5
:N2-Phenyl-1,3,4-oxadiazole-2,5-diamine
Description:
N2-Phenyl-1,3,4-oxadiazole-2,5-diamine, with the CAS number 74099-09-5, is an organic compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This compound features an amine functional group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and materials science. The phenyl group attached to the oxadiazole ring enhances its electronic properties, making it of interest in the development of organic semiconductors and fluorescent materials. Additionally, the presence of amino groups can facilitate hydrogen bonding and increase solubility in polar solvents. The compound may exhibit interesting photophysical properties, which can be exploited in optoelectronic devices. As with many nitrogen-containing heterocycles, it may also possess biological activity, warranting further investigation into its potential therapeutic applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c9-7-11-12-8(13-7)10-6-4-2-1-3-5-6/h1-5H,(H2,9,11)(H,10,12)
InChI key:InChIKey=ZTTVVGLZVROMGF-UHFFFAOYSA-N
SMILES:N(C1=NN=C(N)O1)C2=CC=CC=C2
Synonyms:- 1,3,4-Oxadiazole-2,5-diamine, N-phenyl-
- 1,3,4-Oxadiazole, 2-amino-5-anilino-
- 1,3,4-Oxadiazole-2,5-diamine, N2-phenyl-
- N2-Phenyl-1,3,4-oxadiazole-2,5-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.