CAS 7411-65-6

2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(3-nitrophenyl)ethyl]acetamide

Description:

2,2-Dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(3-nitrophenyl)ethyl]acetamide, with the CAS number 7411-65-6, is a chemical compound characterized by its complex structure, which includes a dichloroacetamide moiety and a chiral center. This compound features a hydroxymethyl group and a nitrophenyl substituent, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of hydroxyl groups. The dichloro substituents can influence its reactivity and stability, making it of interest in various chemical and pharmaceutical applications. The presence of the nitrophenyl group may impart specific electronic properties, potentially affecting its interactions with biological targets. As with many organic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and research applications.

Formula: C₁₁H₁₂Cl₂N₂O₅

InChI: InChI=1/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-2-1-3-7(4-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1

SMILES: c1cc(cc(c1)N(=O)=O)[C@H]([C@@H](CO)N=C(C(Cl)Cl)O)O

m-Chloramphenicol

CAS: 7411-65-6

m-Chloramphenicol, an impurity, hinders bacterial protein synthesis as a potent broad-spectrum antibiotic.

Formula: C₁₁H₁₂Cl₂N₂O₅

Color and Shape: Solid

Molecular weight: 323.13

Ref: TM-T74079

m-nitro-(R,R)-threo-Chloramphenicol

Controlled Product

CAS: 7411-65-6

Stability Hygroscopic
Applications The D-threo-stereoisomer of the m-nitro analog of (+/-)-Chloramphenicol.
References Cammarata, A., et al.: J. Med. Chem., 10, 525 (1967),

Formula: C₁₁H₁₂Cl₂N₂O₅

Color and Shape: Neat

Molecular weight: 323.13

Ref: TR-C325020

m-threo-Chloramphenicol

CAS: 7411-65-6

Formula: C₁₁H₁₂Cl₂N₂O₅

Molecular weight: 323.13

Ref: ST-EA-CP-C161016