CAS 7412-77-3: Protoporphyrinogen IX

Description:Protoporphyrinogen IX is an important organic compound that serves as a precursor in the biosynthesis of heme, a vital component of hemoglobin and various enzymes. It is characterized by its complex structure, which includes a porphyrin ring system with multiple conjugated double bonds, contributing to its ability to absorb light. This compound is typically found in biological systems, particularly in the mitochondria of cells, where it plays a crucial role in the synthesis of heme through a series of enzymatic reactions. Protoporphyrinogen IX is soluble in polar solvents and exhibits a relatively low stability in the presence of light and oxygen, which can lead to its oxidation. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and nitrogen atoms, and it is often studied in the context of metabolic pathways and disorders related to heme synthesis, such as porphyrias. Understanding its properties and behavior is essential for research in biochemistry and medicine, particularly in relation to oxygen transport and cellular respiration.

Formula:C₃₄H₄₀N₄O₄

InChI:InChI=1S/C34H40N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,35-38H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42)

InChI key:InChIKey=UHSGPDMIQQYNAX-UHFFFAOYSA-N

SMILES:O=C(O)CCC1=C2NC(=C1C)CC=3NC(=C(C3C=C)C)CC=4NC(=C(C4C=C)C)CC=5NC(=C(C5C)CCC(=O)O)C2

Synonyms:
21H,23H-porphine-2,18-dipropanoic acid, 7,12-diethenyl-5,10,15,20,22,24-hexahydro-3,8,13,17-tetramethyl-
3,3'-(3,7,12,17-Tetramethyl-8,13-divinyl-5,10,15,20,22,24-hexahydroporphyrin-2,18-diyl)dipropanoic acid
3,3'-[5,9,14,19-Tetramethyl-10,15-divinyl-21,22,23,24-tetraazapentacyclo[16.2.1.1~3,6~.1~8,11~.1~13,16~]tetracosa-1(20),3,5,8,10,13,15,18-octaen-4,20-diyl]dipropans?ure
3,3'-[5,9,14,19-Tetramethyl-10,15-divinyl-21,22,23,24-tetraazapentacyclo[16.2.1.1~3,6~.1~8,11~.1~13,16~]tetracosa-1(20),3,5,8,10,13,15,18-octaene-4,20-diyl]dipropanoic acid
7,12-Diethenyl-5,10,15,20,22,24-hexahydro-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoic acid
7412-77-3
Protogen
Protoporphyrin IX, 5,10,15,20,22,24-hexahydro deriv.
Protoporphyrinogen III
Protoporphyrinogen IX
See more synonyms