CAS 7412-78-4
:Glycyl-L-glutamic acid
Description:
Glycyl-L-glutamic acid, with the CAS number 7412-78-4, is a dipeptide composed of the amino acids glycine and L-glutamic acid. It is characterized by its ability to participate in various biochemical processes, particularly in protein synthesis and metabolism. This compound features both an amino group and a carboxylic acid group, which allows it to act as a zwitterion at physiological pH, possessing both positive and negative charges. Glycyl-L-glutamic acid is soluble in water, making it suitable for various biological applications. It plays a role in neurotransmission and may influence synaptic plasticity due to the presence of the glutamic acid moiety. Additionally, it is often studied for its potential therapeutic effects in neuroprotection and cognitive enhancement. The stability of this dipeptide can be affected by factors such as pH and temperature, which are important considerations in experimental settings. Overall, Glycyl-L-glutamic acid is a significant compound in biochemistry, with implications in both research and potential clinical applications.
Formula:C7H12N2O5
InChI:InChI=1S/C7H12N2O5/c8-3-5(10)9-4(7(13)14)1-2-6(11)12/h4H,1-3,8H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1
InChI key:InChIKey=IEFJWDNGDZAYNZ-BYPYZUCNSA-N
SMILES:[C@H](NC(CN)=O)(CCC(O)=O)C(O)=O
Synonyms:- L-Glutamic acid, glycyl-
- Glycylglutamic acid
- Glutamic acid, N-glycyl-, L-
- Glycyl-L-glutamic acid
- L-Glutamic acid, N-glycyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Glycyl-L-glutamic Acid
CAS:Formula:C7H12N2O5Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:204.18β-Endorphin (30-31) (human)
CAS:The C-terminal dipeptide Gly-Glu was shown to be an effective neurotrophic factor for the maintenance of acetylcholinesterase at both superior cervical ganglia in the denervated cat. Moreover, β-endorphin can bind to serum glycoproteins at sites for which glycyl-L-glutamic acid competes. A potential impurity of glycyl-L-glutamine used as source for L-glutamine.Formula:C7H12N2O5Purity:98.9%Color and Shape:White PowderMolecular weight:204.18(S)-2-(2-Aminoacetamido)Pentanedioic Acid
CAS:(S)-2-(2-Aminoacetamido)Pentanedioic AcidPurity:97%Molecular weight:204.18g/molBeta-Endorphin (30-31) (human)
CAS:Beta-Endorphin (30-31) is a protein that binds to the carotid. It has been shown to promote the growth of bacteria in culture, and is thought to be involved in the regulation of bacterial DNA replication. Beta-Endorphin (30-31) has a molecular weight of approximately 3,000 Daltons and contains two hydroxyl groups. This protein may also be involved in protein synthesis and hydrogen bonding with other proteins.Formula:C7H12N2O5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:204.18 g/mol





