CAS 74124-83-7

Carbamic acid, [1-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]-3-methylbutyl]-, 1,1-dimethylethyl ester

Description:

Carbamic acid, [1-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]-3-methylbutyl]-, 1,1-dimethylethyl ester, identified by CAS number 74124-83-7, is a chemical compound characterized by its complex structure, which includes a carbamate functional group. This compound features a pyrrolidine ring, contributing to its cyclic nature and potentially influencing its reactivity and biological activity. The presence of ester and carbonyl groups suggests that it may participate in various chemical reactions, such as hydrolysis or transesterification. Its molecular structure indicates potential applications in pharmaceuticals or agrochemicals, where such compounds are often utilized for their biological activity. Additionally, the presence of bulky groups, like the 1,1-dimethylethyl moiety, may enhance its lipophilicity, affecting its solubility and permeability in biological systems. Overall, this compound's unique characteristics make it a subject of interest for further research in synthetic chemistry and medicinal applications.

Formula: C₁₅H₂₄N₂O₆

InChI: InChI=1S/C15H24N2O6/c1-9(2)8-10(16-14(21)22-15(3,4)5)13(20)23-17-11(18)6-7-12(17)19/h9-10H,6-8H2,1-5H3,(H,16,21)

InChI key: InChIKey=WXRGJQZMGGGTSS-UHFFFAOYSA-N

SMILES: O(C(C(NC(OC(C)(C)C)=O)CC(C)C)=O)N1C(=O)CCC1=O

Synonyms:

• Carbamic acid, [1-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]-3-methylbutyl]-, 1,1-dimethylethyl ester