CAS 74124-93-9

N-[5-(Aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]acetamide

Description:

N-[5-(Aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]acetamide, with the CAS number 74124-93-9, is a chemical compound characterized by its unique structural features, including an indene core substituted with an aminosulfonyl group and an acetamide moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the sulfonamide and amide functional groups. It may display biological activity, particularly in medicinal chemistry, where such structures are often explored for their potential therapeutic effects. The presence of the sulfonamide group suggests possible interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability and reactivity can be affected by the electronic and steric properties of the substituents on the indene ring. Overall, N-[5-(Aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]acetamide represents a class of compounds that may have significant implications in pharmaceutical research and development.

Formula: C₁₁H₁₄N₂O₃S

InChI: InChI=1S/C11H14N2O3S/c1-7(14)13-10-4-8-2-3-11(17(12,15)16)6-9(8)5-10/h2-3,6,10H,4-5H2,1H3,(H,13,14)(H2,12,15,16)

InChI key: InChIKey=RVPDXKXWYPPTAL-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1CC=2C(C1)=CC=C(S(N)(=O)=O)C2

Synonyms:

• N-[5-(Aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]acetamide
• Acetamide, N-[5-(aminosulfonyl)-2,3-dihydro-1H-inden-2-yl]-