CAS 741271-91-0
:N-(4-amino-2-chlorophenyl)-2-methylpropanamide
Description:
N-(4-amino-2-chlorophenyl)-2-methylpropanamide, with the CAS number 741271-91-0, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical or agrochemical agent. The presence of a 4-amino-2-chlorophenyl moiety suggests that it may exhibit biological activity, possibly as an inhibitor or modulator in various biochemical pathways. The 2-methylpropanamide structure contributes to its lipophilicity, which can influence its solubility and permeability in biological systems. This compound may be solid at room temperature and could exhibit moderate stability under standard conditions. Its molecular interactions may include hydrogen bonding due to the amide group, and it may participate in various chemical reactions typical of amides, such as hydrolysis or acylation. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry, but specific biological activity and toxicity profiles would require further investigation through experimental studies.
Formula:C10H13ClN2O
InChI:InChI=1/C10H13ClN2O/c1-6(2)10(14)13-9-4-3-7(12)5-8(9)11/h3-6H,12H2,1-2H3,(H,13,14)
SMILES:CC(C)C(=Nc1ccc(cc1Cl)N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.