CAS 741287-46-7
:1-Boc-4-Isopropylpiperazine
Description:
1-Boc-4-Isopropylpiperazine, with the CAS number 741287-46-7, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "Boc" (tert-butyloxycarbonyl) group is a protective group commonly used in organic synthesis to temporarily mask amines, enhancing the compound's stability and reactivity during chemical reactions. The isopropyl group attached to the piperazine ring contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound is often utilized in medicinal chemistry and drug development due to its potential pharmacological properties. Its structure allows for various modifications, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the presence of the Boc group facilitates the selective deprotection of the amine functionality, enabling further functionalization. Overall, 1-Boc-4-Isopropylpiperazine serves as an important building block in the synthesis of pharmaceuticals and other chemical entities.
Formula:C12H24N2O2
InChI:InChI=1/C12H24N2O2/c1-10(2)13-6-8-14(9-7-13)11(15)16-12(3,4)5/h10H,6-9H2,1-5H3
SMILES:CC(C)N1CCN(CC1)C(=O)OC(C)(C)C
Synonyms:- 4-Isopropyl-piperazine-1-carboxylic acid tert-butyl ester
- Tert-Butyl 4-(Propan-2-Yl)Piperazine-1-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
