CAS 741287-56-9

Ethanone, 1-[4-(methylthio)-2-pyridinyl]-

Description:

Ethanone, 1-[4-(methylthio)-2-pyridinyl]- is an organic compound characterized by its pyridine ring and a methylthio group. It features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methylthio group enhances its chemical properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate polarity due to the electronegative nitrogen in the pyridine ring and the sulfur in the methylthio group, influencing its solubility in polar solvents. Additionally, the structure suggests potential for hydrogen bonding, which can affect its boiling and melting points. The compound may also exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in synthetic organic chemistry.

Formula: C₈H₉NOS

InChI: InChI=1S/C8H9NOS/c1-6(10)8-5-7(11-2)3-4-9-8/h3-5H,1-2H3

InChI key: InChIKey=SDZHBOGGQVMBQB-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(SC)=CC=N1

Synonyms:

• Ethanone, 1-[4-(methylthio)-2-pyridinyl]-
• 1-(4-(Methylthio)pyridin-2-yl)ethanone