CymitQuimica logo

CAS 741288-57-3

:

Piperazine,1,3,3-trimethyl-

Description:
Piperazine, 1,3,3-trimethyl- is an organic compound characterized by its piperazine backbone, which is a six-membered ring containing two nitrogen atoms. This particular derivative features three methyl groups attached to the piperazine ring, specifically at the 1 and 3 positions. The presence of these methyl groups enhances its lipophilicity and can influence its biological activity. Typically, piperazine derivatives are known for their applications in pharmaceuticals, particularly as anxiolytics, antidepressants, and anti-parasitic agents. The compound may exhibit basic properties due to the nitrogen atoms in the ring, allowing it to form salts with acids. Its molecular structure contributes to its potential interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on the specific functional groups and substituents present. As with many piperazine derivatives, safety and handling precautions should be observed, as they may exhibit varying degrees of toxicity or environmental impact.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-7(2)6-9(3)5-4-8-7/h8H,4-6H2,1-3H3
InChI key:KVWMFPQRDKFZMP-UHFFFAOYSA-N
SMILES:CC1(CN(CCN1)C)C
Synonyms:
  • 1,3,3-Trimethylpiperazine
Found 4 products.