CAS 741288-80-2
:O1-tert-butyl O2-ethyl piperazine-1,2-dicarboxylate hydrochloride
Description:
O1-tert-butyl O2-ethyl piperazine-1,2-dicarboxylate hydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two carboxylate groups, contributing to its potential as a versatile building block in medicinal chemistry. The tert-butyl and ethyl substituents enhance its lipophilicity, which may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. The hydrochloride salt form indicates that the compound is likely to be more soluble in water, facilitating its use in various applications, including drug formulation. Its structure suggests potential interactions with biological targets, making it of interest in the development of therapeutic agents. As with many piperazine derivatives, it may exhibit a range of biological activities, including effects on the central nervous system or other physiological pathways. However, specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C12H23ClN2O4
InChI:InChI=1/C12H22N2O4.ClH/c1-5-17-10(15)9-8-13-6-7-14(9)11(16)18-12(2,3)4;/h9,13H,5-8H2,1-4H3;1H
SMILES:CCOC(=O)C1CNCCN1C(=O)OC(C)(C)C.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.