CAS 74129-12-7

4-Bromo-3-methylbenzenesulfonic acid

Description:

4-Bromo-3-methylbenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of a bromine atom and a methyl group on a benzene ring, along with a sulfonic acid functional group (-SO3H). This compound typically appears as a white to off-white solid and is soluble in water due to the polar sulfonic acid group. It is known for its strong acidity, which is a common feature of sulfonic acids, making it useful in various chemical reactions and applications, including as a reagent in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the bromine atom can also impart unique reactivity, allowing for further functionalization of the molecule. Safety precautions should be taken when handling this compound, as it may be harmful if ingested or inhaled, and appropriate protective equipment should be used. Overall, 4-Bromo-3-methylbenzenesulfonic acid is a valuable compound in synthetic organic chemistry.

Formula: C₇H₇BrO₃S

InChI: InChI=1S/C7H7BrO3S/c1-5-4-6(12(9,10)11)2-3-7(5)8/h2-4H,1H3,(H,9,10,11)

InChI key: InChIKey=LHCSRGCJHCBUMZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=CC(C)=C(Br)C=C1

Synonyms:

• 4-Bromo-3-methylbenzenesulfonic acid
• Benzenesulfonic acid, 4-bromo-3-methyl-