CAS 74129-15-0
:2-(4-bromobenzyl)pyridine
Description:
2-(4-Bromobenzyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a bromobenzyl group attached to the second position of the pyridine ring, contributing to its unique chemical properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its solubility can vary, often being soluble in organic solvents while having limited solubility in water. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-(4-bromobenzyl)pyridine is a versatile compound with significant implications in chemical research and development.
Formula:C12H10BrN
InChI:InChI=1/C12H10BrN/c13-11-6-4-10(5-7-11)9-12-3-1-2-8-14-12/h1-8H,9H2
SMILES:c1ccnc(c1)Cc1ccc(cc1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.