CAS 74129-19-4
:mastoparan polistes jadwagae
Description:
Mastoparan polistes jadwagae is a peptide derived from the venom of the wasp species Polistes jadwagae. It is known for its ability to interact with cell membranes, exhibiting properties that can disrupt membrane integrity and influence cellular processes. This peptide is characterized by its amphipathic nature, which allows it to insert into lipid bilayers, leading to membrane permeabilization. Mastoparan polistes jadwagae has been studied for its potential biological activities, including antimicrobial and cytotoxic effects, making it of interest in pharmacological research. Additionally, it may play a role in modulating immune responses due to its interaction with various cell types. The CAS number 74129-19-4 uniquely identifies this compound in chemical databases, facilitating its study and application in various scientific fields. Overall, mastoparan polistes jadwagae represents a fascinating example of how natural products can be harnessed for their biological activities and potential therapeutic applications.
Formula:C77H127N21O18
InChI:InChI=1/C77H127N21O18/c1-13-43(11)63(97-68(107)50(24-18-20-28-79)88-66(105)49(23-17-19-27-78)89-70(109)54(31-45-34-84-48-22-16-15-21-47(45)48)91-71(110)56(33-60(102)103)93-74(113)61(81)41(7)8)75(114)85-36-59(101)87-51(25-26-58(80)100)67(106)92-55(32-46-35-83-38-86-46)72(111)98-64(44(12)14-2)77(116)94-53(30-40(5)6)69(108)95-57(37-99)73(112)96-62(42(9)10)76(115)90-52(65(82)104)29-39(3)4/h15-16,21-22,34-35,38-44,49-57,61-64,84,99H,13-14,17-20,23-33,36-37,78-79,81H2,1-12H3,(H2,80,100)(H2,82,104)(H,83,86)(H,85,114)(H,87,101)(H,88,105)(H,89,109)(H,90,115)(H,91,110)(H,92,106)(H,93,113)(H,94,116)(H,95,108)(H,96,112)(H,97,107)(H,98,111)(H,102,103)/t43-,44-,49-,50-,51-,52-,53-,54-,55-,56-,57-,61-,62-,63-,64-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](CCC(=N)O)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CC(C)C)C(=N[C@@H](CO)C(=N[C@@H](C(C)C)C(=N[C@@H](CC(C)C)C(=N)O)O)O)O)O)O)O)O)O)N=C([C@H](CCCCN)N=C([C@H](CCCCN)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](CC(=O)O)N=C([C@H](C(C)C)N)O)O)O)O)O
Synonyms:- Polistes mastoparan
- Mast cell degranulating peptide (polistes jadwagae)
- Val-Asp-Trp-Lys-Lys-Ile-Gly-Gln-His-Ile-Leu-Ser-Val-Leu-Nh2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Polistes mastoparan
CAS:<p>Polistes mastoparan, an antimicrobial peptide, enhances K+ efflux in S. aureus cells and reduces cell viability, exhibiting an EC50 of 5 μM [1].</p>Formula:C77H127N21O18Color and Shape:SolidMolecular weight:1634.96Polistes Mastoparan
CAS:<p>Polistes mastoparan is a peptide that was extracted from the venom of the European beewolf. It has been shown to have high affinity for tumor cells and can be used as a diagnostic agent. Polistes mastoparan has also been shown to have anti-inflammatory properties and inhibit the formation rate of glycopeptide antibiotics. This peptide can bind to calmodulin, which may be due to its β-amino acid sequence. Polistes mastoparan inhibits the growth of Stenotrophomonas maltophilia in vitro by binding to fatty acids on the cell membrane.</p>Formula:C77H127N21O18Purity:Min. 95%Molecular weight:1,634.96 g/mol

