CAS 74130-05-5
:4-(4-Bromophenoxy)piperidine
Description:
4-(4-Bromophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a bromophenoxy group, where a bromine atom is substituted on a phenyl ring that is connected via an ether linkage to the piperidine. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, owing to its hydrophobic aromatic components. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the bromine atom can influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for various applications, including as a building block in the synthesis of more complex molecules or as a ligand in drug discovery. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C11H14BrNO
InChI:InChI=1S/C11H14BrNO/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11/h1-4,11,13H,5-8H2
InChI key:InChIKey=KELAIWLMVFYRJD-UHFFFAOYSA-N
SMILES:O(C1=CC=C(Br)C=C1)C2CCNCC2
Synonyms:- 4-(4-Bromophenoxy)piperidine
- 4-[(4-Bromophenyl)oxy]piperidine
- Piperidine, 4-(4-bromophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
