CAS 74133-20-3

4-Methoxypyridine-3-carbonitrile

Description:

4-Methoxypyridine-3-carbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 4-position and a cyano group (-CN) at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is soluble in polar organic solvents, which makes it useful in various chemical reactions and applications. The cyano group is known for its reactivity, allowing for further functionalization, while the methoxy group can influence the compound's electronic properties and reactivity. 4-Methoxypyridine-3-carbonitrile is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c1-10-7-2-3-9-5-6(7)4-8/h2-3,5H,1H3

SMILES: COc1ccncc1C#N

Synonyms:

• 4-Methoxy-nicotinonitrile

4-Methoxypyridine-3-carbonitrile

CAS: 74133-20-3

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA00FAXF

4-Methoxynicotinonitrile

CAS: 74133-20-3

4-Methoxynicotinonitrile

Purity: 97%

Molecular weight: 134.14g/mol

Ref: 54-OR90242

4-Methoxy-nicotinonitrile

CAS: 74133-20-3

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 134.138

Ref: 10-F047210