CAS 74135-23-2

(3aS,6S)-6,7-dimethoxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran

Description:

The chemical substance known as (3aS,6S)-6,7-dimethoxy-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran, with the CAS number 74135-23-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates a dioxole and pyran moiety. This compound features multiple functional groups, including methoxy groups, which contribute to its chemical reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The stereochemistry indicated by the (3aS,6S) configuration suggests specific spatial arrangements of atoms that can influence the compound's biological activity and interaction with other molecules. Its trimethyl groups enhance hydrophobic characteristics, potentially affecting solubility and permeability in biological systems. Overall, this compound exemplifies the intricate nature of organic chemistry, where structural variations can lead to diverse properties and functionalities. Further studies would be necessary to explore its specific applications and biological effects.

Formula: C₁₁H₂₀O₅

InChI: InChI=1/C11H20O5/c1-6-7-8(16-11(2,3)15-7)9(12-4)10(13-5)14-6/h6-10H,1-5H3/t6?,7-,8?,9?,10-/m0/s1

SMILES: CC1[C@H]2C(C([C@@H](OC)O1)OC)OC(C)(C)O2

Methyl 6-Deoxy-2-O-methyl-3,4-O-isopropylidene-α-D-galactopyranoside

CAS: 74135-23-2

Molecular weight: 232.27

Ref: 7W-GC2673

Methyl 6-deoxy-3,4-O-isopropylidene-2-O-methyl-α-D-galactopyranoside

CAS: 74135-23-2

Methyl 6-deoxy-3,4-O-isopropylidene-2-O-methyl-a-D-galactopyranoside is a custom synthesis that can be modified with fluorination, methylation, and monosaccharide modification. This product can also be used in click modification, oligosaccharide synthesis, saccharide modification, and glycosylation. Methyl 6-deoxy-3,4-O-isopropylidene-2-O-methyl-aD galactopyranoside is a CAS No. 7413523 2 and is a Polysaccharide. It has Carbohydrate properties and complex carbohydrate characteristics.

Formula: C₁₁H₂₀O₅

Purity: Min. 95%

Molecular weight: 232.28 g/mol

Ref: 3D-MM09723