CAS 74140-65-1
:7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl beta-D-glucopyranosiduronic acid
Description:
7-Chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl beta-D-glucopyranosiduronic acid, with CAS number 74140-65-1, is a complex organic compound that belongs to the benzodiazepine class, characterized by its fused benzene and diazepine rings. This substance features a chloro substituent and a phenyl group, which contribute to its unique chemical properties and potential biological activity. The presence of the glucopyranosiduronic acid moiety suggests that it may exhibit solubility in water and could interact with biological systems, possibly influencing pharmacokinetics and pharmacodynamics. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions with biological targets, such as receptors or enzymes, would require further investigation through experimental studies. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function, highlighting the importance of structural modifications in drug design.
Formula:C22H20Cl2N2O8
InChI:InChI=1/C22H20Cl2N2O8/c1-26-13-7-6-9(23)8-11(13)14(10-4-2-3-5-12(10)24)25-19(20(26)30)34-22-17(29)15(27)16(28)18(33-22)21(31)32/h2-8,15-19,22,27-29H,1H3,(H,31,32)/t15-,16-,17+,18-,19?,22-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lormetazepam Glucuronide
CAS:Controlled ProductFormula:C22H20Cl2N2O8Color and Shape:NeatMolecular weight:511.31
