CAS 74144-43-7

6-benzoyl-2-naphthyl phosphate disodium

Description:

6-Benzoyl-2-naphthyl phosphate disodium, with the CAS number 74144-43-7, is a chemical compound characterized by its phosphate ester structure. It features a naphthalene ring system substituted with a benzoyl group, which contributes to its unique properties. This compound is typically used in biochemical applications, particularly as a substrate in enzyme assays due to its ability to release naphthol upon hydrolysis. The disodium salt form enhances its solubility in aqueous solutions, making it suitable for various laboratory settings. Its stability under standard conditions allows for reliable use in experiments, while its photochemical properties may be exploited in studies involving light-induced reactions. Additionally, the presence of the phosphate group suggests potential interactions with biological molecules, making it of interest in biochemical research. Overall, 6-benzoyl-2-naphthyl phosphate disodium serves as a valuable tool in the study of enzymatic processes and other chemical reactions involving phosphate esters.

Formula: C₁₇H₁₁Na₂O₅P

InChI: InChI=1/C17H13O5P.2Na/c18-17(12-4-2-1-3-5-12)15-7-6-14-11-16(22-23(19,20)21)9-8-13(14)10-15;;/h1-11H,(H2,19,20,21);;/q;2*+1/p-2

SMILES: c1ccc(cc1)C(=O)c1ccc2cc(ccc2c1)OP(=O)(O)O.[Na].[Na]

Synonyms:

• 6-Benzoyl-2-naphthyl phosphate, sodium salt
• Disodium 6-Benzoyl-2-Naphthyl Phosphate
• Disodium 6-Benzoylnaphthalen-2-Yl Phosphate

6-Benzoyl-2-naphthylphosphate disodium salt

CAS: 74144-43-7

6-Benzoyl-2-naphthylphosphate disodium salt is a chromogenic substrate used to detect and quantify alkaline phosphatase activity. After enzymatic hydrolysis, 6-benzoyl-2-naphthol is released, which can be detect or even further react with other reagents (e.g. Fast Red) to increase the intensity of the colorimetric signal. It is used in common applications such as ELISA, immunohistochemistry and Western Blotting.

Purity: Min. 95%

Molecular weight: 374.24 g/mol

Ref: 3D-EB67206