
CAS 74145-78-1
:2H-Pyran-2-one, 4-methoxy-3-methyl-6-[7-methyl-8-(tetrahydro-3,4-dihydroxy-2,4,5-trimethyl-2-furanyl)-1,3,5,7-octatetraenyl]-, [2R-[2α(1E,3E,5E,7E),3β,4α,5α]]-
Description:
2H-Pyran-2-one, 4-methoxy-3-methyl-6-[7-methyl-8-(tetrahydro-3,4-dihydroxy-2,4,5-trimethyl-2-furanyl)-1,3,5,7-octatetraenyl]-, with the CAS number 74145-78-1, is a complex organic compound characterized by its unique structural features, including a pyranone core and multiple substituents that contribute to its chemical properties. This compound exhibits a range of functional groups, including methoxy, methyl, and hydroxyl groups, which can influence its reactivity and solubility. The presence of a tetrahydro-dihydroxy-furanyl moiety suggests potential for hydrogen bonding and increased polarity. Additionally, the octatetraenyl chain indicates a degree of unsaturation, which may impart specific electronic properties and reactivity patterns. Such compounds are often studied for their potential biological activities, including antioxidant or antimicrobial properties, due to the presence of multiple functional groups that can interact with biological systems. Overall, the intricate structure of this compound suggests a rich chemistry that could be explored for various applications in pharmaceuticals or materials science.
Formula:C23H30O6
InChI:InChI=1S/C23H30O6/c1-15(14-22(4)21(25)23(5,26)17(3)29-22)11-9-7-8-10-12-18-13-19(27-6)16(2)20(24)28-18/h7-14,17,21,25-26H,1-6H3/b8-7+,11-9+,12-10+,15-14+/t17-,21+,22+,23+/m0/s1
InChI key:InChIKey=QPSHETAOAVLQIF-AYGDVHJDSA-N
SMILES:C(=C(/C=C/C=C/C=C/C1=CC(OC)=C(C)C(=O)O1)\C)\[C@]2(C)[C@@H](O)[C@](C)(O)[C@H](C)O2
Synonyms:- 2H-Pyran-2-one, 4-methoxy-3-methyl-6-[7-methyl-8-(tetrahydro-3,4-dihydroxy-2,4,5-trimethyl-2-furanyl)-1,3,5,7-octatetraenyl]-, [2R-[2α(1E,3E,5E,7E),3β,4α,5α]]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Citreoviridin-C
CAS:Citreoviridin-C is a useful organic compound for research related to life sciences. The catalog number is T124293 and the CAS number is 74145-78-1.Formula:C23H30O6Color and Shape:SolidMolecular weight:402.487
