CymitQuimica logo

CAS 74149-74-9

:

N-[2-Amino-4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]-4-methoxybenzamide

Description:
N-[2-Amino-4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]-4-methoxybenzamide, with the CAS number 74149-74-9, is a chemical compound characterized by its complex structure, which includes an amide functional group, an amino group, and a pyridazine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The tetrahydro-pyridazine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for pharmacological properties, including anti-inflammatory or anticancer activities. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C19H20N4O3
InChI:InChI=1S/C19H20N4O3/c1-11-9-17(24)22-23-18(11)13-5-8-16(15(20)10-13)21-19(25)12-3-6-14(26-2)7-4-12/h3-8,10-11H,9,20H2,1-2H3,(H,21,25)(H,22,24)
InChI key:InChIKey=WJMJXFIZZSXKST-UHFFFAOYSA-N
SMILES:CC1C(=NNC(=O)C1)C2=CC(N)=C(NC(=O)C3=CC=C(OC)C=C3)C=C2
Synonyms:
  • Benzamide, N-[2-amino-4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]-4-methoxy-
  • N-[2-Amino-4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]-4-methoxybenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.