
CAS 74150-30-4
:Methyl 4-(ethylthio)-3-oxobutanoate
Description:
Methyl 4-(ethylthio)-3-oxobutanoate, with the CAS number 74150-30-4, is an organic compound characterized by its ester functional group and a ketone moiety. It features a methyl ester group, which contributes to its solubility in organic solvents, and an ethylthio substituent that enhances its reactivity and potential applications in organic synthesis. The compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. Its structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions, making it useful in the synthesis of more complex molecules. Additionally, the presence of the ethylthio group may impart specific properties, such as increased lipophilicity, which can influence its behavior in biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H12O3S
InChI:InChI=1S/C7H12O3S/c1-3-11-5-6(8)4-7(9)10-2/h3-5H2,1-2H3
InChI key:InChIKey=JRZOPJWLYKXNSP-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)(CSCC)=O
Synonyms:- Methyl 4-(ethylthio)-3-oxobutanoate
- Butanoic acid, 4-(ethylthio)-3-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.