CAS 74161-27-6

6-Methoxy-2-methyl-4,7-benzofurandione

Description:

6-Methoxy-2-methyl-4,7-benzofurandione, also known by its CAS number 74161-27-6, is an organic compound characterized by its unique benzofuran structure, which consists of a fused benzene and furan ring. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) that contribute to its chemical properties and reactivity. It is typically a yellow to orange solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity in various chemical reactions, including electrophilic substitutions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₈O₄

InChI: InChI=1S/C10H8O4/c1-5-3-6-7(11)4-8(13-2)9(12)10(6)14-5/h3-4H,1-2H3

InChI key: InChIKey=DNQLVCZXYPFUHF-UHFFFAOYSA-N

SMILES: O=C1C2=C(C(=O)C(OC)=C1)OC(C)=C2

Synonyms:

• 4,7-Benzofurandione, 6-methoxy-2-methyl-
• 6-Methoxy-2-methyl-4,7-benzofurandione
• Acamelin

Acamelin

CAS: 74161-27-6

Acamelin is a quinone isolated from the Australian black wood acacia melanoxylon. It is responsible for the allergy-inducing properties of the species.

Formula: C₁₀H₈O₄

Color and Shape: Solid

Molecular weight: 192.17

Ref: TM-T29545