CymitQuimica logo

CAS 74165-69-8

:

Bicyclo[2.2.1]heptane-7-methanesulfonic acid, 2-bromo-4,7-dimethyl-3-oxo-, ammonium salt (1:1)

Description:
Bicyclo[2.2.1]heptane-7-methanesulfonic acid, 2-bromo-4,7-dimethyl-3-oxo-, ammonium salt (1:1), with CAS number 74165-69-8, is a complex organic compound characterized by its bicyclic structure, which consists of a seven-membered ring system. The presence of a methanesulfonic acid group contributes to its acidity and solubility in polar solvents, while the ammonium salt form indicates that it can participate in ionic interactions. The compound features bromine and methyl substituents, which can influence its reactivity and steric properties. The ketone functional group (3-oxo) adds to its potential for undergoing various chemical transformations. This compound may exhibit interesting biological activity due to its structural features, making it of interest in medicinal chemistry and synthetic applications. Its unique bicyclic framework and functional groups suggest potential uses in pharmaceuticals or as intermediates in organic synthesis. However, specific applications and biological effects would require further investigation and characterization.
Formula:C10H15BrO4S·H3N
InChI:InChI=1S/C10H15BrO4S.H3N/c1-9-4-3-6(7(11)8(9)12)10(9,2)5-16(13,14)15;/h6-7H,3-5H2,1-2H3,(H,13,14,15);1H3
InChI key:InChIKey=GFBVBBRNPGPROZ-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)C1(C)C2(C)C(=O)C(Br)C1CC2.N
Synonyms:
  • Bicyclo[2.2.1]heptane-7-methanesulfonic acid, 2-bromo-4,7-dimethyl-3-oxo-, ammonium salt (1:1)
  • NSC 142287
  • Bicyclo[2.2.1]heptane-7-methanesulfonic acid, 3-bromo-1,7-dimethyl-2-oxo-, ammonium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.