CAS 74165-74-5

3-Amino-5-methoxybenzoic acid

Description:

3-Amino-5-methoxybenzoic acid, with the CAS number 74165-74-5, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a methoxy group (-OCH3) on a benzoic acid framework. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The amino group contributes to its basicity, while the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The methoxy group can influence the compound's electronic properties and reactivity, making it of interest in medicinal chemistry and organic synthesis. Additionally, 3-amino-5-methoxybenzoic acid may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its stability and reactivity can be affected by environmental conditions, such as pH and temperature, which are important considerations in its handling and application.

Formula: C₈H₉NO₃

InChI: InChI=1S/C8H9NO3/c1-12-7-3-5(8(10)11)2-6(9)4-7/h2-4H,9H2,1H3,(H,10,11)

InChI key: InChIKey=DBEMTZANGFGKMX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(OC)=CC(N)=C1

Synonyms:

• Benzoic acid, 3-amino-5-methoxy-
• 3-Amino-5-methoxybenzoic acid

3-Amino-5-methoxybenzoic acid

CAS: 74165-74-5

Formula: C₈H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.1620

Ref: IN-DA003IWL

3-Amino-5-methoxybenzoic acid

CAS: 74165-74-5

Ref: 7W-GM9241

3-Amino-5-methoxybenzoic acid

CAS: 74165-74-5

3-Amino-5-methoxybenzoic acid

Purity: 97%

Molecular weight: 167.16g/mol

Ref: 54-OR345404

3-Amino-5-methoxybenzoic acid

CAS: 74165-74-5

Formula: C₈H₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 167.164

Ref: 10-F036142

3-Amino-5-methoxybenzoic acid

CAS: 74165-74-5

3-Amino-5-methoxybenzoic acid is a macrocyclist, which means that it can switch between two different forms. When the temperature is below 27 degrees Celsius, it exists as a mesomorphic phase and when the temperature increases above 27 degrees Celsius, it exists as an isotropic phase. 3-Amino-5-methoxybenzoic acid also has homologues that are also mesomorphic or isotropic depending on their temperatures. The chemoenzymatic parameters of the two phases are different and so are their lamellar morphologies. The fluorine atom in 3-amino-5-methoxybenzoic acid makes it act like a Lewis acid, decreasing its melting point and increasing its vapor pressure. There are two isomers of 3-amino-5-methoxybenzoic acid: dodecyl and octadecyl 3--amino--5--methoxyben

Formula: C₈H₉NO₃

Purity: Min. 95%

Color and Shape: White To Yellow To Light Brown Solid

Molecular weight: 167.16 g/mol

Ref: 3D-FA67923