CAS 741670-71-3

2-Amino-N,N-dimethyl-4-pyridinemethanamine

Description:

2-Amino-N,N-dimethyl-4-pyridinemethanamine, also known by its CAS number 741670-71-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group and two dimethyl groups attached to the nitrogen, contributing to its basicity and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its solubility in polar solvents, such as water and alcohols, is notable, which can facilitate its use in biological and chemical applications. Additionally, due to its structural features, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₃N₃

InChI: InChI=1S/C8H13N3/c1-11(2)6-7-3-4-10-8(9)5-7/h3-5H,6H2,1-2H3,(H2,9,10)

InChI key: InChIKey=JXAOKSJVAAOSEM-UHFFFAOYSA-N

SMILES: C(N(C)C)C=1C=C(N)N=CC1

Synonyms:

• 2-Amino-N,N-dimethyl-4-pyridinemethanamine
• 4-((Dimethylamino)methyl)pyridin-2-amine
• [4-[(Dimethylamino)methyl]pyridin-2-yl]amine
• 4-Pyridinemethanamine, 2-amino-N,N-dimethyl-

4-[(Dimethylamino)methyl]pyridin-2-amine

CAS: 741670-71-3

Versatile small molecule scaffold

Formula: C₈H₁₃N₃

Purity: Min. 95%

Molecular weight: 151.21 g/mol

Ref: 3D-REB67071